Skip to main content
Back to Matrices & Determinants
JEE Main 2020
Matrices & Determinants
Matrices and Determinants
Medium

Question

Let A = \left( {\matrix{ 1 & { - 1} & 0 \cr 0 & 1 & { - 1} \cr 0 & 0 & 1 \cr } } \right) and B = 7A 20 - 20A 7 + 2I, where I is an identity matrix of order 3 ×\times 3. If B = [b ij ], then b 13 is equal to _____________.

Answer: 1

Solution

Key Concept: Binomial Theorem for Matrices and Nilpotent Matrices

This problem involves calculating high powers of a matrix. Directly multiplying matrices 20 or 7 times is computationally intensive and error-prone. The key insight is to recognize the special structure of matrix AA and express it as a sum of the identity matrix II and a nilpotent matrix NN.

The Binomial Theorem for Matrices states that if two matrices XX and YY commute (i.e., XY=YXXY = YX), then for any positive integer nn: (X+Y)n=k=0n(nk)XnkYk=(n0)XnY0+(n1)Xn1Y1+(n2)Xn2Y2++(nn)X0Yn(X+Y)^n = \sum_{k=0}^n \binom{n}{k} X^{n-k} Y^k = \binom{n}{0}X^n Y^0 + \binom{n}{1}X^{n-1}Y^1 + \binom{n}{2}X^{n-2}Y^2 + \dots + \binom{n}{n}X^0 Y^n A nilpotent matrix NN is a square matrix such that Nk=0N^k = \mathbf{0} (the zero matrix) for some positive integer kk. The smallest such kk is called the index of nilpotency. If NN is nilpotent, many terms in its polynomial expansion (like in the Binomial Theorem) will vanish, significantly simplifying calculations.

Step 1: Decompose Matrix A into I + N

First, let's analyze the given matrix AA: A = \left( {\matrix{ 1 & { - 1} & 0 \cr 0 & 1 & { - 1} \cr 0 & 0 & 1 \cr } } \right) Notice that AA is an upper triangular matrix with all diagonal elements equal to 1. Such matrices can often be expressed as the sum of the identity matrix II and a strictly upper triangular (and thus nilpotent) matrix NN. Let A=I+NA = I + N. Then N=AIN = A - I: N = \left( {\matrix{ 1 & { - 1} & 0 \cr 0 & 1 & { - 1} \cr 0 & 0 & 1 \cr } } \right) - \left( {\matrix{ 1 & 0 & 0 \cr 0 & 1 & 0 \cr 0 & 0 & 1 \cr } } \right) = \left( {\matrix{ 0 & { - 1} & 0 \cr 0 & 0 & { - 1} \cr 0 & 0 & 0 \cr } } \right)

Step 2: Determine the Nilpotency Index of N

Now, let's calculate powers of NN to find its nilpotency index. N^2 = N \cdot N = \left( {\matrix{ 0 & { - 1} & 0 \cr 0 & 0 & { - 1} \cr 0 & 0 & 0 \cr } } \right) \left( {\matrix{ 0 & { - 1} & 0 \cr 0 & 0 & { - 1} \cr 0 & 0 & 0 \cr } } \right) = \left( {\matrix{ 0 & 0 & 1 \cr 0 & 0 & 0 \cr 0 & 0 & 0 \cr } } \right) N^3 = N^2 \cdot N = \left( {\matrix{ 0 & 0 & 1 \cr 0 & 0 & 0 \cr 0 & 0 & 0 \cr } } \right) \left( {\matrix{ 0 & { - 1} & 0 \cr 0 & 0 & { - 1} \cr 0 & 0 & 0 \cr } } \right) = \left( {\matrix{ 0 & 0 & 0 \cr 0 & 0 & 0 \cr 0 & 0 & 0 \cr } } \right) = \mathbf{0} Since N3=0N^3 = \mathbf{0}, NN is a nilpotent matrix of index 3. This means Nk=0N^k = \mathbf{0} for all k3k \ge 3. This property is crucial for simplifying higher powers of AA.

Step 3: Calculate Powers of A using the Binomial Theorem

Since A=I+NA = I + N and the identity matrix II commutes with any matrix NN (i.e., IN=NI=NIN = NI = N), we can apply the Binomial Theorem directly: An=(I+N)n=(n0)InN0+(n1)In1N1+(n2)In2N2+(n3)In3N3+A^n = (I+N)^n = \binom{n}{0}I^n N^0 + \binom{n}{1}I^{n-1}N^1 + \binom{n}{2}I^{n-2}N^2 + \binom{n}{3}I^{n-3}N^3 + \dots Because N3=0N^3 = \mathbf{0}, all terms with NkN^k for k3k \ge 3 will be zero. Thus, for any n2n \ge 2: An=(n0)I+(n1)N+(n2)N2A^n = \binom{n}{0}I + \binom{n}{1}N + \binom{n}{2}N^2 An=I+nN+n(n1)2N2A^n = I + nN + \frac{n(n-1)}{2}N^2

Now, let's calculate A20A^{20} and A7A^7: For A20A^{20} (here n=20n=20): A20=I+20N+20(201)2N2=I+20N+20×192N2=I+20N+190N2A^{20} = I + 20N + \frac{20(20-1)}{2}N^2 = I + 20N + \frac{20 \times 19}{2}N^2 = I + 20N + 190N^2 For A7A^7 (here n=7n=7): A7=I+7N+7(71)2N2=I+7N+7×62N2=I+7N+21N2A^7 = I + 7N + \frac{7(7-1)}{2}N^2 = I + 7N + \frac{7 \times 6}{2}N^2 = I + 7N + 21N^2

Step 4: Substitute into the Expression for B

The matrix BB is given by B=7A2020A7+2IB = 7A^{20} - 20A^7 + 2I. Substitute the expressions for A20A^{20} and A7A^7: B=7(I+20N+190N2)20(I+7N+21N2)+2IB = 7(I + 20N + 190N^2) - 20(I + 7N + 21N^2) + 2I

Step 5: Simplify Matrix B

Distribute the scalar coefficients and group terms by II, NN, and N2N^2: B=(7I+140N+1330N2)(20I+140N+420N2)+2IB = (7I + 140N + 1330N^2) - (20I + 140N + 420N^2) + 2I B=(720+2)I+(140140)N+(1330420)N2B = (7 - 20 + 2)I + (140 - 140)N + (1330 - 420)N^2 B=(11)I+(0)N+(910)N2B = (-11)I + (0)N + (910)N^2 So, B=11I+910N2B = -11I + 910N^2.

Step 6: Find the Element b13b_{13}

We need to find b13b_{13}, which is the element in the first row and third column of matrix BB. Let's look at the (1,3)(1,3) elements of II and N2N^2: I = \left( {\matrix{ 1 & 0 & 0 \cr 0 & 1 & 0 \cr 0 & 0 & 1 \cr } } \right) \implies (I)_{13} = 0 N^2 = \left( {\matrix{ 0 & 0 & 1 \cr 0 & 0 & 0 \cr 0 & 0 & 0 \cr } } \right) \implies (N^2)_{13} = 1 Now, substitute these values into the expression for BB: b13=11(I)13+910(N2)13b_{13} = -11(I)_{13} + 910(N^2)_{13} b13=11(0)+910(1)b_{13} = -11(0) + 910(1) b13=0+910b_{13} = 0 + 910 b13=910b_{13} = 910

Common Mistakes to Avoid:

  • Incorrectly calculating powers of N: Double-check matrix multiplication, especially for off-diagonal elements.
  • Forgetting to distribute scalar multiples: Ensure all terms inside the parentheses are multiplied by their respective coefficients.
  • Assuming nilpotency for non-strictly triangular matrices: Only strictly upper or strictly lower triangular matrices are guaranteed to be nilpotent.
  • Applying Binomial Theorem without checking commutativity: The theorem (X+Y)n(X+Y)^n only works if XY=YXXY = YX. Here, II commutes with any matrix NN, so it's valid.

Summary and Key Takeaway: The final answer is 910\boxed{910}. This problem demonstrates the power of recognizing special matrix structures. By decomposing AA into I+NI+N where NN is nilpotent, we could use the Binomial Theorem to efficiently calculate high powers of AA. This method avoids tedious matrix multiplications and simplifies the entire problem into a polynomial evaluation for II, NN, and N2N^2. This approach is particularly effective for matrices that are "perturbations" of the identity matrix.

Practice More Matrices & Determinants Questions

View All Questions