Skip to main content
Back to Matrices & Determinants
JEE Main 2024
Matrices & Determinants
Matrices and Determinants
Medium

Question

Let A = \left[ {\matrix{ i & { - i} \cr { - i} & i \cr } } \right],i = \sqrt { - 1} . Then, the system of linear equations A8[\matrixx\cry\cr]=[\matrix8\cr64\cr]{A^8}\left[ {\matrix{ x \cr y \cr } } \right] = \left[ {\matrix{ 8 \cr {64} \cr } } \right] has :

Options

Solution

Key Concepts and Formulas

  • Determinant of a Matrix: For a 2×22 \times 2 matrix M = \left[ {\matrix{ a & b \cr c & d \cr } } \right], its determinant is det(M)=adbc\det(M) = ad - bc.
  • Determinant of Matrix Powers: For any square matrix MM and positive integer nn, det(Mn)=(det(M))n\det(M^n) = (\det(M))^n.
  • Nature of Solutions for a System of Linear Equations (PX=QPX=Q):
    • If det(P)0\det(P) \neq 0, the system has a unique solution.
    • If det(P)=0\det(P) = 0, the system is either inconsistent (no solution) or has infinitely many solutions. To distinguish:
      • No Solution: If Rank(PP) \neq Rank([PQ][P|Q]), where [PQ][P|Q] is the augmented matrix. This means the equations are contradictory.
      • Infinitely Many Solutions: If Rank(PP) = Rank([PQ][P|Q]) << number of variables. This means the equations are consistent and dependent.
  • Fundamental Principle: A system of linear equations can never have exactly two solutions. The possible number of solutions are 0, 1, or infinitely many.

Step-by-Step Solution

Step 1: Calculate the Determinant of Matrix AA

First, we need to find the determinant of the given matrix AA. This will help us determine if AA is invertible. A = \left[ {\matrix{ i & { - i} \cr { - i} & i \cr } } \right] Using the formula for a 2×22 \times 2 determinant: det(A)=(i)(i)(i)(i)\det(A) = (i)(i) - (-i)(-i) Since i2=1i^2 = -1: det(A)=(1)(1)=1+1=0\det(A) = (-1) - (-1) = -1 + 1 = 0 Reasoning: A determinant of zero indicates that the matrix AA is singular (non-invertible). This is a crucial first step for analyzing the system of equations.

Step 2: Calculate the Determinant of A8A^8

Next, we use the property of determinants that det(Mn)=(det(M))n\det(M^n) = (\det(M))^n. Applying this to A8A^8: det(A8)=(det(A))8\det(A^8) = (\det(A))^8 Substitute the value of det(A)\det(A) calculated in Step 1: det(A8)=(0)8=0\det(A^8) = (0)^8 = 0 Reasoning: Since det(A8)=0\det(A^8) = 0, the matrix A8A^8 is also singular. This immediately tells us that the system A8[\matrixx\cry\cr]=[\matrix8\cr64\cr]A^8 \left[ {\matrix{ x \cr y \cr } } \right] = \left[ {\matrix{ 8 \cr {64} \cr } } \right] does not have a unique solution. We must now determine if it has no solution or infinitely many solutions.

Step 3: Calculate the Matrix A8A^8 Explicitly

To analyze the system further, we need the actual form of A8A^8. Let's simplify AA and find a pattern for its powers. Observe that AA can be written as a scalar multiple of a simpler matrix: A = i \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right] Let B = \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right]. So, A=iBA = iB. Now, let's compute powers of BB: B^2 = B \cdot B = \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right] \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right] = \left[ {\matrix{ (1)(1)+(-1)(-1) & (1)(-1)+(-1)(1) \cr (-1)(1)+(1)(-1) & (-1)(-1)+(1)(1) \cr } } \right] B^2 = \left[ {\matrix{ 1+1 & -1-1 \cr -1-1 & 1+1 \cr } } \right] = \left[ {\matrix{ 2 & { - 2} \cr { - 2} & 2 \cr } } \right] We can factor out 22 from B2B^2: B^2 = 2 \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right] = 2B This shows a pattern: Bn=2n1BB^n = 2^{n-1}B. Let's verify for B3B^3: B3=B2B=(2B)B=2B2=2(2B)=4B=22BB^3 = B^2 \cdot B = (2B) \cdot B = 2B^2 = 2(2B) = 4B = 2^2 B. The pattern Bn=2n1BB^n = 2^{n-1}B is confirmed.

Now we can find A8A^8: A8=(iB)8=i8B8A^8 = (iB)^8 = i^8 B^8 First, calculate i8i^8: Since i4=(i2)2=(1)2=1i^4 = (i^2)^2 = (-1)^2 = 1, then i8=(i4)2=12=1i^8 = (i^4)^2 = 1^2 = 1. Next, calculate B8B^8 using the pattern Bn=2n1BB^n = 2^{n-1}B: B8=281B=27B=128BB^8 = 2^{8-1}B = 2^7 B = 128B Substitute these results back into the expression for A8A^8: A8=1(128B)=128BA^8 = 1 \cdot (128B) = 128B Finally, substitute the matrix BB back: A^8 = 128 \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right] = \left[ {\matrix{ 128 & { - 128} \cr { - 128} & 128 \cr } } \right] Reasoning: Factoring ii from AA allowed us to simplify calculations by finding a recursive relation for powers of the real matrix BB. This is an efficient method for computing high powers of matrices.

Step 4: Analyze the System of Linear Equations

The given system is A8[\matrixx\cry\cr]=[\matrix8\cr64\cr]A^8 \left[ {\matrix{ x \cr y \cr } } \right] = \left[ {\matrix{ 8 \cr {64} \cr } } \right]. Substitute the calculated A8A^8: \left[ {\matrix{ 128 & { - 128} \cr { - 128} & 128 \cr } } \right] \left[ {\matrix{ x \cr y \cr } } \right] = \left[ {\matrix{ 8 \cr {64} \cr } } \right] This matrix equation translates into a system of two linear equations:

  1. 128x128y=8128x - 128y = 8
  2. 128x+128y=64-128x + 128y = 64

Let's simplify these equations: Divide equation (1) by 128: xy=8128    xy=116x - y = \frac{8}{128} \implies x - y = \frac{1}{16} Divide equation (2) by 128-128: xy=64128    xy=12x - y = \frac{64}{-128} \implies x - y = -\frac{1}{2} Reasoning: Converting the matrix equation into a standard system of linear equations allows us to easily check for consistency and dependence.

Step 5: Determine the Number of Solutions

We now have the simplified system: xy=116x - y = \frac{1}{16} xy=12x - y = -\frac{1}{2} These two equations are contradictory because 11612\frac{1}{16} \neq -\frac{1}{2}. It is impossible for xyx-y to simultaneously equal two different values. Therefore, there is no pair of values (x,y)(x, y) that can satisfy both equations. The system of linear equations is inconsistent.

Thus, based on standard linear algebra principles, the system has no solution.

Common Mistakes & Tips

  • Understanding Solution Types: A fundamental error is believing a system of linear equations can have "exactly two solutions". For any linear system, the number of solutions must be 0 (no solution), 1 (unique solution), or infinitely many. There are no other possibilities.
  • Determinant for Consistency: Always check the determinant of the coefficient matrix first. If it's non-zero, a unique solution exists. If it's zero, further analysis (like checking the rank of the augmented matrix or simplifying the equations) is required to distinguish between no solution and infinitely many solutions.
  • Pattern Recognition: For high powers of matrices, look for patterns (A2=kAA^2=kA, A2=kIA^2=kI, etc.) or try to diagonalize the matrix if possible. Direct multiplication is usually inefficient.

Summary

We began by calculating the determinant of matrix AA, which was found to be 0. This implied that A8A^8 would also have a determinant of 0, ruling out a unique solution for the system. We then computed A8A^8 by recognizing a pattern in the powers of a simplified matrix related to AA. This led to A^8 = 128 \left[ {\matrix{ 1 & { - 1} \cr { - 1} & 1 \cr } } \right]. Substituting A8A^8 into the system of equations yielded two contradictory linear equations: xy=1/16x-y = 1/16 and xy=1/2x-y = -1/2. This inconsistency means that the system has no solution.

The final answer is A\boxed{A}.

Practice More Matrices & Determinants Questions

View All Questions