Skip to main content
Back to Matrices & Determinants
JEE Main 2021
Matrices & Determinants
Matrices and Determinants
Hard

Question

Let θ=π5\theta = {\pi \over 5} and A = \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right]. If B = A + A 4 , then det (B) :

Options

Solution

Here's a detailed and educational solution to the problem:

Understanding the Key Concepts

The problem involves a special type of matrix known as a rotation matrix. A 2×22 \times 2 matrix of the form R(\theta) = \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right] represents a counter-clockwise rotation by an angle θ\theta in a 2D plane.

A crucial property of rotation matrices is that if A=R(θ)A = R(\theta), then An=R(nθ)A^n = R(n\theta). This means applying a rotation by θ\theta n times is equivalent to a single rotation by nθn\theta.

We will also use the determinant formula for a 2×22 \times 2 matrix: for M=[abcd]M = \begin{bmatrix} a & b \\ c & d \end{bmatrix}, det(M)=adbc\det(M) = ad - bc. Finally, several trigonometric identities will be essential:

  • cos2x+sin2x=1\cos^2 x + \sin^2 x = 1
  • cosAcosB+sinAsinB=cos(AB)\cos A \cos B + \sin A \sin B = \cos(A-B)
  • cos(πx)=cosx\cos(\pi - x) = -\cos x
  • cos(90+x)=sinx\cos(90^\circ + x) = -\sin x
  • The standard value of sin(18)=514\sin(18^\circ) = \frac{\sqrt{5}-1}{4}.

Step-by-Step Solution

Step 1: Identify Matrix A as a Rotation Matrix and find its general power AnA^n.

The given matrix is: A = \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right] This matrix is precisely a rotation matrix, R(θ)R(\theta), representing a rotation by an angle θ\theta.

Let's compute A2A^2 to see the pattern: A^2 = A \cdot A = \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right] \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right] A^2 = \left[ {\matrix{ {\cos^2 \theta - \sin^2 \theta } & {\cos \theta \sin \theta + \sin \theta \cos \theta } \cr { - \sin \theta \cos \theta - \cos \theta \sin \theta } & { - \sin^2 \theta + \cos^2 \theta } \cr } } \right] Using the double angle formulas (cos2θ=cos2θsin2θ\cos 2\theta = \cos^2 \theta - \sin^2 \theta and sin2θ=2sinθcosθ\sin 2\theta = 2\sin \theta \cos \theta): A^2 = \left[ {\matrix{ {\cos 2\theta } & {\sin 2\theta } \cr { - \sin 2\theta } & {\cos 2\theta } \cr } } \right] This confirms the property for n=2n=2. By repeatedly applying this multiplication (or more formally, by mathematical induction), we can generalize this to any positive integer nn: A^n = \left[ {\matrix{ {\cos n\theta } & {\sin n\theta } \cr { - \sin n\theta } & {\cos n\theta } \cr } } \right] Tip: Recognizing this specific matrix form as a rotation matrix is key to solving many problems efficiently. If you don't recognize it, you'd have to perform matrix multiplication repeatedly, which is prone to errors and time-consuming.

Step 2: Calculate A4A^4.

Using the general formula for AnA^n with n=4n=4: A^4 = \left[ {\matrix{ {\cos 4\theta } & {\sin 4\theta } \cr { - \sin 4\theta } & {\cos 4\theta } \cr } } \right]

Step 3: Calculate Matrix B.

The problem defines B=A+A4B = A + A^4. We perform element-wise matrix addition: B = \left[ {\matrix{ {\cos \theta } & {\sin \theta } \cr { - \sin \theta } & {\cos \theta } \cr } } \right] + \left[ {\matrix{ {\cos 4\theta } & {\sin 4\theta } \cr { - \sin 4\theta } & {\cos 4\theta } \cr } } \right] B = \left[ {\matrix{ {\cos \theta + \cos 4\theta } & {\sin \theta + \sin 4\theta } \cr { - \sin \theta - \sin 4\theta } & {\cos \theta + \cos 4\theta } \cr } } \right] B = \left[ {\matrix{ {\cos 4\theta + \cos \theta } & {\sin 4\theta + \sin \theta } \cr { - (\sin 4\theta + \sin \theta) } & {\cos 4\theta + \cos \theta } \cr } } \right]

Step 4: Calculate det(B)\det(B).

For a matrix M=[abcd]M = \begin{bmatrix} a & b \\ c & d \end{bmatrix}, det(M)=adbc\det(M) = ad - bc. Here, a=cos4θ+cosθa = \cos 4\theta + \cos \theta, b=sin4θ+sinθb = \sin 4\theta + \sin \theta, c=(sin4θ+sinθ)c = -(\sin 4\theta + \sin \theta), and d=cos4θ+cosθd = \cos 4\theta + \cos \theta. det(B)=(cos4θ+cosθ)(cos4θ+cosθ)(sin4θ+sinθ)((sin4θ+sinθ))\det(B) = (\cos 4\theta + \cos \theta)(\cos 4\theta + \cos \theta) - (\sin 4\theta + \sin \theta)(-(\sin 4\theta + \sin \theta)) det(B)=(cos4θ+cosθ)2+(sin4θ+sinθ)2\det(B) = (\cos 4\theta + \cos \theta)^2 + (\sin 4\theta + \sin \theta)^2 Expand the squares: det(B)=(cos24θ+cos2θ+2cos4θcosθ)+(sin24θ+sin2θ+2sin4θsinθ)\det(B) = (\cos^2 4\theta + \cos^2 \theta + 2\cos 4\theta \cos \theta) + (\sin^2 4\theta + \sin^2 \theta + 2\sin 4\theta \sin \theta) Rearrange terms and group them to use trigonometric identities: det(B)=(cos24θ+sin24θ)+(cos2θ+sin2θ)+2(cos4θcosθ+sin4θsinθ)\det(B) = (\cos^2 4\theta + \sin^2 4\theta) + (\cos^2 \theta + \sin^2 \theta) + 2(\cos 4\theta \cos \theta + \sin 4\theta \sin \theta) Using the identity cos2x+sin2x=1\cos^2 x + \sin^2 x = 1: det(B)=1+1+2(cos4θcosθ+sin4θsinθ)\det(B) = 1 + 1 + 2(\cos 4\theta \cos \theta + \sin 4\theta \sin \theta) Using the compound angle identity cos(AB)=cosAcosB+sinAsinB\cos(A-B) = \cos A \cos B + \sin A \sin B: det(B)=2+2cos(4θθ)\det(B) = 2 + 2 \cos(4\theta - \theta) det(B)=2+2cos(3θ)\det(B) = 2 + 2 \cos(3\theta) Tip: Be careful with signs when applying the determinant formula, especially when elements are negative. Also, always look for opportunities to simplify using fundamental trigonometric identities.

Step 5: Substitute the value of θ\theta and evaluate the trigonometric term.

Given θ=π5\theta = \frac{\pi}{5}. Substitute this into the expression for det(B)\det(B): det(B)=2+2cos(3π5)=2+2cos(3π5)\det(B) = 2 + 2 \cos\left(3 \cdot \frac{\pi}{5}\right) = 2 + 2 \cos\left(\frac{3\pi}{5}\right) Now, we need to evaluate cos(3π5)\cos\left(\frac{3\pi}{5}\right). We know that 3π5\frac{3\pi}{5} is 108108^\circ. We can use the identity cos(πx)=cosx\cos(\pi - x) = -\cos x: cos(3π5)=cos(π2π5)=cos(2π5)\cos\left(\frac{3\pi}{5}\right) = \cos\left(\pi - \frac{2\pi}{5}\right) = -\cos\left(\frac{2\pi}{5}\right) Alternatively, we can use cos(90+x)=sinx\cos(90^\circ + x) = -\sin x: cos(3π5)=cos(108)=cos(90+18)=sin(18)\cos\left(\frac{3\pi}{5}\right) = \cos(108^\circ) = \cos(90^\circ + 18^\circ) = -\sin(18^\circ) The value of sin(18)\sin(18^\circ) is a standard result that should be memorized or derived: sin(18)=514\sin(18^\circ) = \frac{\sqrt{5}-1}{4} Therefore, cos(3π5)=514\cos\left(\frac{3\pi}{5}\right) = -\frac{\sqrt{5}-1}{4} Substitute this back into the determinant expression: det(B)=2+2(514)\det(B) = 2 + 2 \left(-\frac{\sqrt{5}-1}{4}\right) det(B)=2512\det(B) = 2 - \frac{\sqrt{5}-1}{2} To simplify, find a common denominator: det(B)=4(51)2=45+12=552\det(B) = \frac{4 - (\sqrt{5}-1)}{2} = \frac{4 - \sqrt{5} + 1}{2} = \frac{5 - \sqrt{5}}{2} **Common Mistake

Practice More Matrices & Determinants Questions

View All Questions