Skip to main content
Back to Sequences & Series
JEE Main 2020
Sequences & Series
Sequences and Series
Hard

Question

23131×7+4333+23132×11+6353+4333+23133×15++303293+283273++231315×63 \frac{2^{3}-1^{3}}{1 \times 7}+\frac{4^{3}-3^{3}+2^{3}-1^{3}}{2 \times 11}+\frac{6^{3}-5^{3}+4^{3}-3^{3}+2^{3}-1^{3}}{3 \times 15}+\cdots+ \frac{30^{3}-29^{3}+28^{3}-27^{3}+\ldots+2^{3}-1^{3}}{15 \times 63} is equal to _____________.

Answer: 1

Solution

  1. Key Concepts and Formulas

    • Difference of Cubes: a3b3=(ab)(a2+ab+b2)a^3 - b^3 = (a-b)(a^2+ab+b^2).
    • Summation of Powers: k=1nk=n(n+1)2\sum_{k=1}^{n} k = \frac{n(n+1)}{2}, k=1nk2=n(n+1)(2n+1)6\sum_{k=1}^{n} k^2 = \frac{n(n+1)(2n+1)}{6}, k=1nc=cn\sum_{k=1}^{n} c = cn.
    • Arithmetic Progression: an=a1+(n1)da_n = a_1 + (n-1)d.
    • Pattern Recognition and Algebraic Simplification for series terms.
  2. Step-by-Step Solution

Step 1: Identify the structure of the nn-th term (TnT_n) of the series.

Let's analyze the given terms: The first term is T1=23131×7T_1 = \frac{2^3-1^3}{1 \times 7}. The second term is T2=4333+23132×11T_2 = \frac{4^3-3^3+2^3-1^3}{2 \times 11}. The third term is T3=6353+4333+23133×15T_3 = \frac{6^3-5^3+4^3-3^3+2^3-1^3}{3 \times 15}. The series continues until the 1515-th term, which has 1515 in the denominator. This suggests that the series has 1515 terms in total, indexed from n=1n=1 to n=15n=15.

  • Numerator (NnN_n): The numerator of the nn-th term is a sum of nn pairs of differences of cubes. Each pair is of the form (2k)3(2k1)3(2k)^3 - (2k-1)^3. For T1T_1 (n=1n=1): (21)3(211)3=2313(2 \cdot 1)^3 - (2 \cdot 1 - 1)^3 = 2^3 - 1^3. For T2T_2 (n=2n=2): (4333)+(2313)=k=12[(2k)3(2k1)3](4^3 - 3^3) + (2^3 - 1^3) = \sum_{k=1}^{2} [(2k)^3 - (2k-1)^3]. For T3T_3 (n=3n=3): (6353)+(4333)+(2313)=k=13[(2k)3(2k1)3](6^3 - 5^3) + (4^3 - 3^3) + (2^3 - 1^3) = \sum_{k=1}^{3} [(2k)^3 - (2k-1)^3]. Thus, the general numerator is Nn=k=1n[(2k)3(2k1)3]N_n = \sum_{k=1}^{n} \left[ (2k)^3 - (2k-1)^3 \right].

  • Denominator (DnD_n): The denominator of the nn-th term has two factors. The first factor is nn. The second factor forms an arithmetic progression: 7,11,15,7, 11, 15, \ldots. The first term is a1=7a_1 = 7 and the common difference is d=117=4d = 11-7 = 4. The nn-th term of this AP is an=a1+(n1)d=7+(n1)4=7+4n4=4n+3a_n = a_1 + (n-1)d = 7 + (n-1)4 = 7 + 4n - 4 = 4n+3. We can verify this for the last term: for n=15n=15, the second factor is 4(15)+3=60+3=634(15)+3 = 60+3 = 63, which matches the given last term. So, the general denominator is Dn=n(4n+3)D_n = n(4n+3).

Therefore, the nn-th term of the series is Tn=k=1n[(2k)3(2k1)3]n(4n+3)T_n = \frac{\sum_{k=1}^{n} \left[ (2k)^3 - (2k-1)^3 \right]}{n(4n+3)}.

Step 2: Simplify the expression inside the summation in the numerator.

We use the difference of cubes formula a3b3=(ab)(a2+ab+b2)a^3 - b^3 = (a-b)(a^2+ab+b^2) with a=2ka=2k and b=2k1b=2k-1. ab=(2k)(2k1)=1a-b = (2k) - (2k-1) = 1. So, (2k)3(2k1)3=(1)[(2k)2+(2k)(2k1)+(2k1)2](2k)^3 - (2k-1)^3 = (1) \left[ (2k)^2 + (2k)(2k-1) + (2k-1)^2 \right]. Expanding the terms: (2k)2=4k2(2k)^2 = 4k^2. (2k)(2k1)=4k22k(2k)(2k-1) = 4k^2 - 2k. (2k1)2=(2k)22(2k)(1)+12=4k24k+1(2k-1)^2 = (2k)^2 - 2(2k)(1) + 1^2 = 4k^2 - 4k + 1. Summing these: (2k)3(2k1)3=4k2+(4k22k)+(4k24k+1)=12k26k+1(2k)^3 - (2k-1)^3 = 4k^2 + (4k^2 - 2k) + (4k^2 - 4k + 1) = 12k^2 - 6k + 1.

Step 3: Calculate the general numerator (NnN_n) by summing the simplified expression.

Now, we sum the simplified expression from k=1k=1 to nn: Nn=k=1n(12k26k+1)N_n = \sum_{k=1}^{n} (12k^2 - 6k + 1). Using the linearity of summation and the standard sum formulas: Nn=12k=1nk26k=1nk+k=1n1N_n = 12 \sum_{k=1}^{n} k^2 - 6 \sum_{k=1}^{n} k + \sum_{k=1}^{n} 1. Substitute the formulas: Nn=12(n(n+1)(2n+1)6)6(n(n+1)2)+nN_n = 12 \left( \frac{n(n+1)(2n+1)}{6} \right) - 6 \left( \frac{n(n+1)}{2} \right) + n. Simplify: Nn=2n(n+1)(2n+1)3n(n+1)+nN_n = 2n(n+1)(2n+1) - 3n(n+1) + n. Factor out nn: Nn=n[2(n+1)(2n+1)3(n+1)+1]N_n = n [2(n+1)(2n+1) - 3(n+1) + 1]. Expand and simplify inside the brackets: Nn=n[2(2n2+3n+1)3n3+1]N_n = n [2(2n^2 + 3n + 1) - 3n - 3 + 1]. Nn=n[4n2+6n+23n2]N_n = n [4n^2 + 6n + 2 - 3n - 2]. Nn=n[4n2+3n]N_n = n [4n^2 + 3n]. Factor out nn again: Nn=nn(4n+3)=n2(4n+3)N_n = n \cdot n(4n+3) = n^2(4n+3).

Step 4: Simplify the general term (TnT_n).

Substitute the simplified numerator NnN_n back into the expression for TnT_n: Tn=n2(4n+3)n(4n+3)T_n = \frac{n^2(4n+3)}{n(4n+3)}. Since nn ranges from 11 to 1515, n0n \neq 0 and 4n+304n+3 \neq 0. We can cancel the common factors nn and (4n+3)(4n+3): Tn=nT_n = n. This is a surprisingly simple form for the nn-th term.

Step 5: Calculate the total sum of the series.

The series has 1515 terms, from n=1n=1 to n=15n=15. The sum SS is given by: S=n=115TnS = \sum_{n=1}^{15} T_n. Since Tn=nT_n = n: S=n=115nS = \sum_{n=1}^{15} n. Using the formula for the sum of the first NN natural numbers, n=1Nn=N(N+1)2\sum_{n=1}^{N} n = \frac{N(N+1)}{2}, with N=15N=15: S=15(15+1)2S = \frac{15(15+1)}{2}. S=15×162S = \frac{15 \times 16}{2}. S=15×8S = 15 \times 8. S=120S = 120.

  1. Common Mistakes & Tips

    • Incorrectly identifying the pattern: Double-check the structure of the numerator and denominator for the general term with the first few given terms.
    • Algebraic errors in simplification: Be meticulous when expanding and combining terms, especially with the difference of cubes and summation formulas.
    • Misinterpreting the number of terms: The last term's denominator usually provides a clue to the total number of terms in the series.
  2. Summary The problem involves a series where each term's numerator is a sum of differences of cubes, and the denominator follows a pattern related to the term number. By carefully identifying the general nn-th term, simplifying the numerator using the difference of cubes identity and summation formulas, and then cancelling common factors with the denominator, we found that the nn-th term simplifies to nn. The sum of the series is then the sum of the first 1515 natural numbers, which is 120120.

The final answer is 120\boxed{120}.

Practice More Sequences & Series Questions

View All Questions