Skip to main content
Back to Definite Integration
JEE Main 2019
Definite Integration
Definite Integration
Hard

Question

In=0π/4tannxdx{I_n} = \int\limits_0^{\pi /4} {{{\tan }^n}x\,dx} then limnn[In+In+2]\,\mathop {\lim }\limits_{n \to \infty } \,n\left[ {{I_n} + {I_{n + 2}}} \right] equals

Options

Solution

Key Concepts and Formulas

  • Properties of Definite Integrals: abf(x)dx+abg(x)dx=ab(f(x)+g(x))dx\int_a^b f(x) dx + \int_a^b g(x) dx = \int_a^b (f(x) + g(x)) dx.
  • Trigonometric Identity: 1+tan2x=sec2x1 + \tan^2 x = \sec^2 x.
  • Integration by Substitution: If u=f(x)u = f(x), then du=f(x)dxdu = f'(x) dx. The limits of integration must be changed accordingly.
  • Limit of a Rational Function: limnP(n)Q(n)\mathop {\lim }\limits_{n \to \infty } \frac{P(n)}{Q(n)}, where P(n)P(n) and Q(n)Q(n) are polynomials in nn.

Step-by-Step Solution

Step 1: Simplify the expression In+In+2I_n + I_{n+2} We are given In=0π/4tannxdxI_n = \int\limits_0^{\pi /4} {{{\tan }^n}x\,dx}. We need to find a simplified form for In+In+2I_n + I_{n+2}. In+In+2=0π/4tannxdx+0π/4tann+2xdxI_n + I_{n+2} = \int\limits_0^{\pi /4} {{{\tan }^n}x\,dx} + \int\limits_0^{\pi /4} {{{\tan }^{n + 2}}x\,dx} Using the property of definite integrals, we can combine these two integrals since they have the same limits of integration: In+In+2=0π/4(tannx+tann+2x)dxI_n + I_{n+2} = \int\limits_0^{\pi /4} \left( {{{\tan }^n}x + {{\tan }^{n + 2}}x} \right)\,dx Reasoning: The first step is to combine the given integral terms to simplify the expression that the limit will be applied to.

Step 2: Factor and apply trigonometric identity Inside the integral, we can factor out the common term tannx\tan^n x: In+In+2=0π/4tannx(1+tan2x)dxI_n + I_{n+2} = \int\limits_0^{\pi /4} {{{\tan }^n}x \left( {1 + {{\tan }^2}x} \right)\,dx} Now, we use the fundamental trigonometric identity 1+tan2x=sec2x1 + \tan^2 x = \sec^2 x: In+In+2=0π/4tannxsec2xdxI_n + I_{n+2} = \int\limits_0^{\pi /4} {{{\tan }^n}x\,{\sec ^2}x\,dx} Reasoning: Factoring out tannx\tan^n x is a strategic move to reveal a structure that can be simplified using a trigonometric identity. The presence of sec2x\sec^2 x, which is the derivative of tanx\tan x, strongly suggests an integration by substitution.

Step 3: Evaluate the integral using substitution Let u=tanxu = \tan x. Then, du=sec2xdxdu = \sec^2 x\,dx. We need to change the limits of integration: When x=0x = 0, u=tan(0)=0u = \tan(0) = 0. When x=π4x = \frac{\pi}{4}, u=tan(π4)=1u = \tan\left(\frac{\pi}{4}\right) = 1. Substituting uu and dudu into the integral, with the new limits: In+In+2=01unduI_n + I_{n+2} = \int\limits_0^1 {{u^n}\,du} Now, we evaluate this standard integral: In+In+2=[un+1n+1]01I_n + I_{n+2} = \left[ {\frac{{{u^{n + 1}}}}{{n + 1}}} \right]_0^1 In+In+2=(1)n+1n+1(0)n+1n+1I_n + I_{n+2} = \frac{{{{\left( 1 \right)}^{n + 1}}}}{{n + 1}} - \frac{{{{\left( 0 \right)}^{n + 1}}}}{{n + 1}} In+In+2=1n+10I_n + I_{n+2} = \frac{1}{{n + 1}} - 0 In+In+2=1n+1I_n + I_{n+2} = \frac{1}{{n + 1}} Reasoning: The substitution u=tanxu = \tan x transforms the trigonometric integral into a simple power function integral, which is straightforward to evaluate using the power rule for integration. Crucially, the limits of integration are adjusted to match the new variable uu.

Step 4: Evaluate the limit We need to find the limit of n[In+In+2]n\left[ {{I_n} + {I_{n + 2}}} \right] as nn \to \infty. Substitute the simplified expression for In+In+2I_n + I_{n+2}: limnn[In+In+2]=limnn[1n+1]\,\mathop {\lim }\limits_{n \to \infty } \,n\left[ {{I_n} + {I_{n + 2}}} \right] = \mathop {\lim }\limits_{n \to \infty } \,n\left[ {\frac{1}{{n + 1}}} \right] =limnnn+1 = \mathop {\lim }\limits_{n \to \infty } \frac{n}{{n + 1}} To evaluate this limit, we divide the numerator and the denominator by the highest power of nn in the denominator, which is nn: =limnnnnn+1n = \mathop {\lim }\limits_{n \to \infty } \frac{{\frac{n}{n}}}{{\frac{n}{n} + \frac{1}{n}}} =limn11+1n = \mathop {\lim }\limits_{n \to \infty } \frac{1}{{1 + \frac{1}{n}}} As nn \to \infty, the term 1n0\frac{1}{n} \to 0. =11+0 = \frac{1}{{1 + 0}} =1 = 1 Reasoning: This step involves evaluating a limit of a rational function as nn approaches infinity. The standard technique is to divide all terms by the highest power of nn in the denominator, which simplifies the expression and allows for the direct evaluation of the limit.

Common Mistakes & Tips

  • Forgetting to change limits of integration: When performing substitution in definite integrals, always update the limits of integration to correspond to the new variable.
  • Incorrectly applying trigonometric identities: Ensure you are using the correct identities, like 1+tan2x=sec2x1 + \tan^2 x = \sec^2 x.
  • Algebraic errors in limit calculation: Be meticulous when dividing by the highest power of nn and simplifying the rational expression for the limit.

Summary

The problem requires evaluating the limit of nn times the sum of two consecutive integrals InI_n and In+2I_{n+2}. The key to solving this problem lies in first simplifying the sum In+In+2I_n + I_{n+2}. By combining the integrals and factoring, we obtain 0π/4tannxsec2xdx\int\limits_0^{\pi /4} {{{\tan }^n}x\,{\sec ^2}x\,dx}. This integral is readily solved using the substitution u=tanxu = \tan x. After evaluating the integral to be 1n+1\frac{1}{n+1}, we then compute the limit limnn(1n+1)\mathop {\lim }\limits_{n \to \infty } n \left(\frac{1}{n+1}\right), which simplifies to 1.

The final answer is 1\boxed{1}.

Practice More Definite Integration Questions

View All Questions